1H-indole-6-carboxylic acid, 2,3-dihydro-, methyl ester - Names and Identifiers
Name | methyl 2,3-dihydro-1H-indole-6-carboxylatato
|
Synonyms | methyl indoline-6-carboxylate Methyl 2,3-dihydro-1H-indole-6-carboxylate Methyl2,3-dihydro-1H-indole-6-carboxylatato methyl 2,3-dihydro-1H-indole-6-carboxylatato Methyl indoline-6-carboxylate in stock Factory 1H-INDOLE-6-CARBOXYLIC ACID,2,3-DIHYDRO-,METHYL ESTER 1H-indole-6-carboxylic acid, 2,3-dihydro-, methyl ester 2,3-DIHYDRO-1H-INDOLE-6-CARBOXYLIC ACID METHYL ESTER HYDROCHLORIDE
|
CAS | 341988-36-1
|
InChI | InChI=1/C10H11NO2/c1-13-10(12)8-3-2-7-4-5-11-9(7)6-8/h2-3,6,11H,4-5H2,1H3 |
1H-indole-6-carboxylic acid, 2,3-dihydro-, methyl ester - Physico-chemical Properties
Molecular Formula | C10H11NO2
|
Molar Mass | 177.2 |
Density | 1.162g/cm3 |
Boling Point | 315.6°C at 760 mmHg |
Flash Point | 144.7°C |
Vapor Presure | 0.000433mmHg at 25°C |
Storage Condition | 2-8°C |
Refractive Index | 1.555 |
1H-indole-6-carboxylic acid, 2,3-dihydro-, methyl ester - Risk and Safety
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
|
HS Code | 29339900 |
1H-indole-6-carboxylic acid, 2,3-dihydro-, methyl ester - Introduction
Methyl 2, is an organic compound that has the following properties:
1. appearance: methyl 2, is colorless liquid or solid.
2. molecular formula: C12H11NO2
3. Molecular weight: 201.22g/mol
4. Melting point: about 50-55°C
5. Boiling point: about 270-280°C
6. density: about 1.24 g/cm
methyl 2, the main uses are as follows:
1. Chemical synthesis: It is an effective intermediate that can be used to synthesize other organic compounds. Especially in the pharmaceutical industry, it can be used to synthesize drugs or biologically active molecules.
2. cosmetics: it can be used as a fragrance chemicals, such as perfume ingredients.
3. research: because of its structural characteristics, methyl 2, is also widely used in the field of chemical research.
methyl 2, the preparation method usually adopts chemical synthesis method, which can be prepared from indoline and methyl formate. The specific preparation method may be variously adjusted as required.
Regarding safety information, methyl 4-formate indoline is an organic compound and should be handled with caution. The following safety measures need to be followed during use:
1. Avoid contact with skin and eyes: Wear appropriate protective gloves, glasses and protective clothing during use.
2. storage and handling: storage should be sealed, avoid direct sunlight and high temperature. Care should be taken to prevent inhalation or ingestion.
3. Waste disposal: Disposal of waste in accordance with local regulations and do not discharge it into the environment.
Last Update:2024-04-09 21:04:16